Is 4 Methyl an acetophenone?
4′-Methylacetophenone, also known as melilot or sweet clover, belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. 4′-Methylacetophenone is a sweet, acetophenone, and bitter almond tasting compound.
What does 4 Methylacetophenone look like?
4-Methylacetophenone, belongs to the class of organic compounds known as alkyl-phenylketones. 4-methylacetophenone is a colorless clear liquid. It is a cumin-like, sweet, vanilla, cream tasting compound and it smells like hawthorn and acacia.
What is the boiling point of 4 Acetyltoluene?
438.9°F (226°C)
p-methyl acetophenone/Boiling point
What is the density of acetophenone?
1.03 g/cm³
Acetophenone/Density
Is 4 Methylacetophenone a ketone?
4′-Methylacetophenone These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group.
Is 4 Methylacetophenone soluble in water?
4-Methylacetophenone (YMDB01619)
| Identification | |
|---|---|
| State | Solid |
| Charge | 0 |
| Melting point | 28 °C |
| Experimental Properties | Property Value Reference Water Solubility 0.372 mg/mL at 15 oC [BEILSTEIN] PhysProp LogP 2.10 [HANSCH,C ET AL. (1995)] PhysProp |
What is the boiling point of acetophenone?
395.6°F (202°C)
Acetophenone/Boiling point
Pure acetophenone is a colourless liquid, with a melting point of 20.2 °C (68.4 °F) and a boiling point of 202.4 °C (396.3 °F). It is only slightly soluble in water but is freely soluble in ethanol (ethyl alcohol), diethyl ether, and chloroform.
What does acetophenone smell like?
Acetophenone appears as a colorless liquid with a sweet pungent taste and odor resembling the odor of oranges. Freezes under cool conditions.
Which is formula of acetophenone?
C8H8O
Acetophenone/Formula
What is the structure of 4 Fluoroacetophenone?
Identification of 4-FLUOROACETOPHENONE Chemical Compound
| Chemical Formula | C8H7FO |
|---|---|
| IUPAC Name | 1-(4-fluorophenyl)ethan-1-one |
| SMILES String | CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H7FO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| InChIKey | ZDPAWHACYDRYIW-UHFFFAOYSA-N |
Why is acetophenone insoluble in water?
Acetophenone is the organic compound with the formula C6H5C(O)CH3 (also represented by the pseudoelement symbols PhAc or BzMe)….Acetophenone.
| Names | |
|---|---|
| Melting point | 19–20 °C (66–68 °F; 292–293 K) |
| Boiling point | 202 °C (396 °F; 475 K) |
| Solubility in water | 5.5 g/L at 25 °C 12.2 g/L at 80 °C |
| Magnetic susceptibility (χ) | -72.05·10−6 cm3/mol |
Why is it called acetophenone?
They all contain the compound Acetophenone. Acetophenone is the simplest ketone derivative of benzene. The name ‘acetophenone’ does not follow conventional IUPAC naming methods, because it is such a simple ketone it is known by the common name of acetophenone. The actual IUPAC name would be: 1-phenylethanone.
What is the chemical formula for 4 methyl acetophenone?
ACETOPHENONE»4 METHYL ACETOPHENONE 4 METHYL ACETOPHENONE Molecular Formula C9H10O Structural Formula Molecular Weight 134.18 gm/mole CAS No. 122 – 00 – 9 Other Names 1-(4-Methylphenyl)ethanone 1-Acetyl-4-methylbenzene 1-p-Tolylethanone Melilotal
What can 4 ′ methylacetophenone be used for?
45-49 °C (lit.) 45-49 °C (lit.) 4′-methylacetophenone can be used as a fragrance material. 4′-Methylacetophenone is wildly occurs in volatile compounds in food and in some natural complex substances (NCS) [1].
How is stereoselective reductive metabolism of acetophenone studied?
Chem. 16 , 1084-9, (2008) Stereoselective reductive metabolism of various p-substituted acetophenone derivatives was studied using isolated rat liver 3alpha-hydroxysteroid dehydrogenase (3alpha-HSD). Kinetic experiments were p…
https://www.youtube.com/watch?v=5x8BjcY2JRU