What is the chemical equation for acetaminophen?
Identification of Acetaminophen Chemical Compound
| Chemical Formula | C8H9NO2 |
|---|---|
| Molecular Weight | 151.16256 g/mol |
| IUPAC Name | N-(4-hydroxyphenyl)acetamide |
| SMILES String | CC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
What reaction is synthesis of acetaminophen?
Preparation of acetaminophen involves treating an amine with an acid anhydride to form an amide. In this case, p-aminophenol, the amine, is treated with acetic anhydride to form acetaminophen (p-acetamidophenol), the amide.
How do you calculate the theoretical yield of paracetamol?
To determine the theoretical yield, multiply the mass of acetaminophen, reported as 0.157g, by the molar mass of acetaminophen. In this instance, it is 151.2g. This results in the theoretical yield being 0.217g.
What is acetaminophen synthesized from?
p-aminophenol
Acetaminophen – Another pharmacologically active compound Acetaminophen, which can be synthesized from p-aminophenol, is probably best recognized under the trade name Tylenol.
What is the chemical components of paracetamol?
However, the aspirin/paracetamol/caffeine combination helps with both conditions where the pain is mild and is recommended as a first-line treatment for them….Paracetamol.
| Clinical data | |
|---|---|
| ECHA InfoCard | 100.002.870 |
| Chemical and physical data | |
| Formula | C8H9NO2 |
| Molar mass | 151.165 g·mol−1 |
How is acetaminophen made?
How is acetaminophen made? First, Paracetamol is made by nitrating phenol, using sulfuric acid or sodium nitrate, and separating the para and ortho isomers. The 4-nitrophenol is then reduced to 4-aminophenol, which then reacts with acetic anhydride to yield the desired compound.
What is the mechanism of action of paracetamol?
The conversion of arachidonic acid to PGG(2) is dependent on a tyrosine-385 radical at the COX site. Formation of a ferryl protoporphyrin IX radical cation from the reducing agent Fe(3+) at the POX site is essential for conversion of tyrosine-385 to its radical form.
How is paracetamol synthesized from phenol?
Paracetamol is prepared from p- aminophenol by acetylating it with acetic anhydride in the presence of 3-4 drops of concentrated sulphuric acid as catalyst.
Who synthesized paracetamol?
Paracetamol was first synthesized in 1878 by Morse, and introduced for medical usage in 1883. However, due to misinterpretation of its safety profile, it enjoyed only limited use until the 1950s, when the chemically similar, and up until then preferred analgesic, phenacetin was withdrawn because of renal toxicity.
How was paracetamol invented?
Harmon Northrop Morse synthesized paracetamol at Johns Hopkins University via the reduction of p-nitrophenol with tin in glacial acetic acid in 1877, but it was not until 1887 that clinical pharmacologist Joseph von Mering tried paracetamol on humans.
How is paracetamol produced?
The starting material for the commercial manufacture of paracetamol is phenol, which is nitrated to give a mixture of the ortho and para-nitrotoluene. The o-isomer is removed by steam distillation, and the p-nitro group reduced to a p-amino group. This is then acetylated to give paracetamol.
What is the empirical formula for paracetamol?
Paracetamol
| Clinical data | |
|---|---|
| ECHA InfoCard | 100.002.870 |
| Chemical and physical data | |
| Formula | C8H9NO2 |
| Molar mass | 151.165 g·mol−1 |
Is acetaminophen and paracetamol the same thing?
Paracetamol is what acetaminophen is called in almost every country in the world apart from the U.S. and Canada (where it is called acetaminophen). Paracetamol is exactly the same as acetaminophen. Paracetamol is used to relieve pain.
What is the difference between acetaminophen and paracetamol?
Paracetamol (more commonly known as acetaminophen) and ibuprofen are both pain relievers, but there are a few differences between them. The primary difference is that ibuprofen is a nonsteroidal anti-inflammatory drug (NSAID), meaning that it treats inflammation.
What are the side effects of acetaminophen?
Acetaminophen side effects: The most common Acetaminophen side effects are abdominal pain, rash, ringing in ears, headaches, dizziness, drowsiness, diarrhea, nausea, heartburn and constipation. Serious Acetaminophen side effects is ulceration of the stomach or intestine, and the ulcers may bleed.
What is the mechanism of action of Tylenol?
Tylenol (acetaminophen) is an analgesic (pain reliever) and antipyretic (fever reducer). The exact mechanism of action of acetaminophen is unknown. It may reduce the production of prostaglandins , which are chemicals that cause inflammation and swelling.