What is the structure of C5H10O2?
C5H10O2
Ethyl propionate/Formula
What is the structure of isopropyl propionate?
Showing Compound Isopropyl propionate (FDB001363)
| Record Information | |
|---|---|
| Chemical Formula | C6H12O2 |
| IUPAC name | propan-2-yl propanoate |
| InChI Identifier | InChI=1S/C6H12O2/c1-4-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| InChI Key | IJMWOMHMDSDKGK-UHFFFAOYSA-N |
What is the properties in of ethyl Propanoate?
It is the ethyl ester of propionic acid. It is a colorless volatile liquid with a pineapple-like odor….Ethyl propionate.
| Names | |
|---|---|
| Density | 0.884325 g/cm3 |
| Melting point | −73.6 °C (−100.5 °F; 199.6 K) |
| Boiling point | 98.9 °C (210.0 °F; 372.0 K) |
| Magnetic susceptibility (χ) | -66.5·10−6 cm3/mol |
What is the use of ethyl Propanoate?
Ethyl propionate is used in perfumery and fragrance. It is used to manufacture various propionates which used in the reduction of pharmaceuticals, anti-fungal agents, agrochemicals, plastics, plasticizers, rubber chemicals, dyes, artificial flavors and perfumery synthetics.
How many structural isomers are there of C5H10O2 that are esters?
A total of 9 structural isomers one of which is chiral for a total of 10 isomers.
What are the isomers of C5H10O2?
C5H10O 2
- tert-Butyl formate.
- Ethyl propionate.
- Isobutyl formate.
- Isopropyl acetate.
- Methylbutanoic acids. 2-Methylbutanoic acid. 3-Methylbutanoic acid (isovaleric acid)
- Methyl butyrate.
- Methyl isobutyrate.
- Pivalic acid.
What is the Iupac name of isopropyl acetylene?
The given compound name is, Ethyl isopropyl acetylene.
What is the Iupac name of isopropyl acetate?
Isopropyl acetate
| Names | |
|---|---|
| Preferred IUPAC name Propan-2-yl acetate | |
| Other names Isopropyl acetate 2-Acetoxypropane 2-Propyl acetate 2-Propyl ethanoate Propan-2-yl ethanoate | |
| Identifiers | |
| CAS Number | 108-21-4 |
What functional groups are in ethyl Propanoate?
Ethyl propanoate, also known as fema 2456, belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom, forming an ester group.
What is the structural formula of ethyl Propanoate?
What is the functional group of ethyl Propanoate?
carboxylic acid esters
Ethyl propionate, also known as fema 2456, belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group).
Are esters functional groups?
Esters are a functional group commonly encountered in organic chemistry. They are characterized by a carbon bound to three other atoms: a single bond to a carbon, a double bond to an oxygen, and a single bond to an oxygen.