What is the molecular structure of aspirin?
C₉H₈O₄
Aspirin/Formula
What is the molecular structure of C9H8O4?
Identification of Aspirin Chemical Compound
| Chemical Formula | C9H8O4 |
|---|---|
| Molecular Weight | 180.15742 g/mol |
| IUPAC Name | 2-(acetyloxy)benzoic acid |
| SMILES String | CC(=O)Oc1ccccc1C(O)=O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
What are the physical properties of aspirin?
Properties of Aspirin
- Its molar mass is 180.16 g/mol.
- Its melting point is 136 ℃.
- Its boiling point is 140 ℃.
- It’s soluble in water. 3g of aspirin can dissolve in 1 liter of water.
- It is a white crystalline solid at room temperature.
- It is weakly acidic in nature.
- Its density is 1.40 g.
What is C9H8O4 used for?
This agent exhibits analgesic, antipyretic, and anticoagulant properties. Also known as Aspirin, acetylsalicylic acid (ASA) is a commonly used drug for the treatment of pain and fever due to various causes. Acetylsalicylic acid has both anti-inflammatory and antipyretic effects.
What is the shape of aspirin?
The molecular geometry is planar because the phenyl ring and the carboxylic groups which have a sp2 hybridization. Its chemical structure can be written as below, in the common representations used for organic molecules. Occurrence: Aspirin can not be found in nature.
What is the structure of aspirin 12?
> Option (C): The given compound has both ester and acid functional groups. It is an acetyl derivative of salicylic acid or 2-hydroxybenzoic acid. It is, therefore, the correct structural formula of aspirin.
What is the correct structure of aspirin select one?
Aspirin, which the chemical name acetylsalicylic acid (ASA), is medication extensively used around the world as an anti-inflammatory and anti-pyretic. Formula and structure: The acetylsalicylic acid chemical formula is C9H8O4 and the extended formula is CH3COOC6H4COOH. The molecular mass is 180.159 g mol-1.
Is aspirin molecular or ionic?
Covalent Compound– The aspirin molecule shown to the left is composed of three different types of atoms: carbon (green), oxygen (red) and hydrogen (white) covalently bound. To view the 3-D structure of aspirin click here.
What is the molecular mass of aspirin C9H8O4?
180.157 g/mol
The molar mass of aspirin with a chemical formula of C9 H8 O4 is 180.157 g/mol.
Is aspirin metabolised in liver?
Salicylate is mainly metabolized in the liver, although other tissues may also be involved in this process Label. The major metabolites of acetylsalicylic acid are salicylic acid, salicyluric acid, the ether or phenolic glucuronide and the ester or acyl glucuronide.
What is the structure of an aspirin molecule?
Structure Of Aspirin. Aspirin is a polar molecule . This means that the charge of the electrons are not equal on all sides. The bond between C and H is strongly covalent and the bond between C and O is moderately covalent. The AX form of Aspirin in Cyclic.
What are the types of molecular structures?
Types of molecular structure. A bond angle is the geometric angle between two adjacent bonds. Some common shapes of simple molecules include: Linear: In a linear model, atoms are connected in a straight line. The bond angles are set at 180°. For example, carbon dioxide and nitric oxide have a linear molecular shape.
Is aspirin an ionic or molecular compound?
Answer: aspirin ( C9H8O4 ) is a covalent bond. What is chemical bond, ionic bond, covalent bond? Chemical bond. A chemical bond is a lasting attraction between atoms, ions or molecules that enables the formation of chemical compounds.
What is the chemistry of aspirin?
Aspirin is known as ‘acetylsalicylic acid’ and has a chemical formula of C9H8O4. It inhibits enzyme converting acid to prostaglandin . Aspirin is pain-relieving, anti-inflammatory, a drug that reduces fewer and is an inhibitor of platelet aggregation.