What is the structure of 1 phenyl methanol?
Phenyl(113C)methanol
| PubChem CID | 12203066 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C7H8O |
| Synonyms | 54522-91-7 Phenyl(113C)methanol Benzyl alcohol-|A-13C Benzyl alcohol- -13C Benzylalcohol-alpha-13c More… |
| Molecular Weight | 109.13 |
What is the structure of 1 phenyl?
Showing Compound 1-Phenyl-1-propanone (FDB010567)
| Record Information | |
|---|---|
| Chemical Formula | C9H10O |
| IUPAC name | |
| InChI Identifier | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChI Key | KRIOVPPHQSLHCZ-UHFFFAOYSA-N |
What is the structure of 2 phenyl?
2-Phenyl-2-butene | C10H12 – PubChem.
What is the shape of phenyl?
Phenyl groups have six carbon atoms bonded together in a hexagonal planar ring, five of which are bonded to individual hydrogen atoms, with the remaining carbon bonded to a substituent. Phenyl groups are commonplace in organic chemistry.
How do you make 1-Phenylethanol?
Racemic 1-phenylethanol is produced by the reduction of acetophenone by sodium borohydride. Alternatively, benzaldehyde can be reacted with methylmagnesium chloride or similar organometallic compounds to afford racemic 1-phenylethanol.
How will you distinguish between 1-phenylethanol and 2 Phenylethanol?
1-phenyl ethanol gives iodoform test, where as 2-phenyl ethanol does not give this test. Give the equations of reaction for the preparation of phenol from cumene. Cumene is oxidised into cumene hydro peroxide by air at high pressure which on decomposition by aqueous acid gives phenol and acetone.
What is the structure of 1 Phenylpropan 2 OL?
1-Phenyl-2-propanol
| PubChem CID | 94185 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H12O |
| Synonyms | 1-Phenyl-2-propanol 1-Phenylpropan-2-ol 698-87-3 Benzyl methyl carbinol 14898-87-4 More… |
| Molecular Weight | 136.19 |
Is 2 phenyl 1 propanol primary or tertiary?
2-phenylpropan-2-ol is a tertiary alcohol that is isopropanol in which the hydrogen attached to the carbon bearing the hydroxy group has been replaced by a phenyl group.
What is the structure of 2/3 Diethylphenol?
Identification of 2,3-diethylphenol Chemical Compound
| Chemical Formula | C10H14O |
|---|---|
| IUPAC Name | 2,3-diethylphenol |
| SMILES String | CCc1cccc(O)c1CC |
| InChI | InChI=1S/C10H14O/c1-3-8-6-5-7-10(11)9(8)4-2/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | RLEWTHFVGOXXTN-UHFFFAOYSA-N |
What is the molecular weight of phenyl?
77.10
Phenyl
| PubChem CID | 123159 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C6H5 |
| Synonyms | Phenyl radical Phenyl 2396-01-2 |
| Molecular Weight | 77.10 |
How do you identify phenyl?
The phenyl group is based simply on benzene, with one H removed. The benzyl group is based on methylbenzene (toluene), with one H removed from the methyl group. Figure 2 shows the molecules benzyl chloride and phenyl chloride; these are based on the groups discussed above.